C21H24FN4O+ — CID 135619443
3-[(2-fluorophenyl)diazenyl]-1-[[(3S)-3-methylpiperidin-1-ium-1-yl]methyl]indol-2-ol (PubChem CID 135619443) has the molecular formula C21H24FN4O+ and a molecular weight of 367.45 g/mol. Its IUPAC name is 3-[(2-fluorophenyl)diazenyl]-1-[[(3S)-3-methylpiperidin-1-ium-1-yl]methyl]indol-2-ol.
| Compound Name | 3-[(2-fluorophenyl)diazenyl]-1-[[(3S)-3-methylpiperidin-1-ium-1-yl]methyl]indol-2-ol |
|---|---|
| PubChem CID | 135619443 |
| Molecular Formula | C21H24FN4O+ |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | 3-[(2-fluorophenyl)diazenyl]-1-[[(3S)-3-methylpiperidin-1-ium-1-yl]methyl]indol-2-ol |
| SMILES | C[C@H]1CCC[NH+](Cn2c(O)c(/N=N/c3ccccc3F)c3ccccc32)C1 |
| InChI | InChI=1S/C21H23FN4O/c1-15-7-6-12-25(13-15)14-26-19-11-5-2-8-16(19)20(21(26)27)24-23-18-10-4-3-9-17(18)22/h2-5,8-11,15,27H,6-7,12-14H2,1H3/p+1/b24-23+/t15-/m0/s1 |
| InChIKey | NZBRCPWBTUFFGC-KGHZBTQCSA-O |
| XLogP | 4.17 |
| TPSA | 54.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|