C20H21FN5OS+ — CID 2013642
1-(4-fluorophenyl)-3-[2-hydroxy-1-(pyrrolidin-1-ium-1-ylmethyl)indol-3-yl]iminothiourea (PubChem CID 2013642) has the molecular formula C20H21FN5OS+ and a molecular weight of 398.49 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-[2-hydroxy-1-(pyrrolidin-1-ium-1-ylmethyl)indol-3-yl]iminothiourea.
| Compound Name | 1-(4-fluorophenyl)-3-[2-hydroxy-1-(pyrrolidin-1-ium-1-ylmethyl)indol-3-yl]iminothiourea |
|---|---|
| PubChem CID | 2013642 |
| Molecular Formula | C20H21FN5OS+ |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 1-(4-fluorophenyl)-3-[2-hydroxy-1-(pyrrolidin-1-ium-1-ylmethyl)indol-3-yl]iminothiourea |
| SMILES | Oc1c(/N=N/C(=S)Nc2ccc(F)cc2)c2ccccc2n1C[NH+]1CCCC1 |
| InChI | InChI=1S/C20H20FN5OS/c21-14-7-9-15(10-8-14)22-20(28)24-23-18-16-5-1-2-6-17(16)26(19(18)27)13-25-11-3-4-12-25/h1-2,5-10,27H,3-4,11-13H2,(H,22,28)/p+1/b24-23+ |
| InChIKey | WJRGLMJIUVLHIZ-WCWDXBQESA-O |
| XLogP | 3.60 |
| TPSA | 66.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|