C18H17FN4O2S — CID 156828461
1-(1-ethyl-5-fluoro-2-hydroxyindol-3-yl)imino-3-(4-methoxyphenyl)thiourea (PubChem CID 156828461) has the molecular formula C18H17FN4O2S and a molecular weight of 372.43 g/mol. Its IUPAC name is 1-(1-ethyl-5-fluoro-2-hydroxyindol-3-yl)imino-3-(4-methoxyphenyl)thiourea.
| Compound Name | 1-(1-ethyl-5-fluoro-2-hydroxyindol-3-yl)imino-3-(4-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 156828461 |
| Molecular Formula | C18H17FN4O2S |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | 1-(1-ethyl-5-fluoro-2-hydroxyindol-3-yl)imino-3-(4-methoxyphenyl)thiourea |
| SMILES | CCn1c(O)c(/N=N/C(=S)Nc2ccc(OC)cc2)c2cc(F)ccc21 |
| InChI | InChI=1S/C18H17FN4O2S/c1-3-23-15-9-4-11(19)10-14(15)16(17(23)24)21-22-18(26)20-12-5-7-13(25-2)8-6-12/h4-10,24H,3H2,1-2H3,(H,20,26)/b22-21+ |
| InChIKey | HEAZJVLQUYOLLJ-QURGRASLSA-N |
| XLogP | 5.00 |
| TPSA | 71.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|