C18H15F3N4O2S — CID 156828499
1-[2-hydroxy-1-methyl-5-(trifluoromethyl)indol-3-yl]imino-3-(4-methoxyphenyl)thiourea (PubChem CID 156828499) has the molecular formula C18H15F3N4O2S and a molecular weight of 408.41 g/mol. Its IUPAC name is 1-[2-hydroxy-1-methyl-5-(trifluoromethyl)indol-3-yl]imino-3-(4-methoxyphenyl)thiourea.
| Compound Name | 1-[2-hydroxy-1-methyl-5-(trifluoromethyl)indol-3-yl]imino-3-(4-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 156828499 |
| Molecular Formula | C18H15F3N4O2S |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | 1-[2-hydroxy-1-methyl-5-(trifluoromethyl)indol-3-yl]imino-3-(4-methoxyphenyl)thiourea |
| SMILES | COc1ccc(NC(=S)/N=N/c2c(O)n(C)c3ccc(C(F)(F)F)cc23)cc1 |
| InChI | InChI=1S/C18H15F3N4O2S/c1-25-14-8-3-10(18(19,20)21)9-13(14)15(16(25)26)23-24-17(28)22-11-4-6-12(27-2)7-5-11/h3-9,26H,1-2H3,(H,22,28)/b24-23+ |
| InChIKey | YDRZYVQNHPLWRW-WCWDXBQESA-N |
| XLogP | 5.39 |
| TPSA | 71.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|