C17H13F3N4O3 — CID 139245061
1-[2-hydroxy-1-methyl-5-(trifluoromethoxy)indol-3-yl]imino-3-phenylurea (PubChem CID 139245061) has the molecular formula C17H13F3N4O3 and a molecular weight of 378.31 g/mol. Its IUPAC name is 1-[2-hydroxy-1-methyl-5-(trifluoromethoxy)indol-3-yl]imino-3-phenylurea.
| Compound Name | 1-[2-hydroxy-1-methyl-5-(trifluoromethoxy)indol-3-yl]imino-3-phenylurea |
|---|---|
| PubChem CID | 139245061 |
| Molecular Formula | C17H13F3N4O3 |
| Molecular Weight | 378.31 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | 1-[2-hydroxy-1-methyl-5-(trifluoromethoxy)indol-3-yl]imino-3-phenylurea |
| SMILES | Cn1c(O)c(/N=N/C(=O)Nc2ccccc2)c2cc(OC(F)(F)F)ccc21 |
| InChI | InChI=1S/C17H13F3N4O3/c1-24-13-8-7-11(27-17(18,19)20)9-12(13)14(15(24)25)22-23-16(26)21-10-5-3-2-4-6-10/h2-9,25H,1H3,(H,21,26)/b23-22+ |
| InChIKey | AOISHMZACGWCMT-GHVJWSGMSA-N |
| XLogP | 5.10 |
| TPSA | 88.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.31 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|