C30H32N4O4S — CID 135438393
4-[2-[1-hexyl-2-hydroxy-3-(phenylcarbamoyldiazenyl)indol-5-yl]sulfanylethyl]benzoic acid (PubChem CID 135438393) has the molecular formula C30H32N4O4S and a molecular weight of 544.68 g/mol. Its IUPAC name is 4-[2-[1-hexyl-2-hydroxy-3-(phenylcarbamoyldiazenyl)indol-5-yl]sulfanylethyl]benzoic acid.
| Compound Name | 4-[2-[1-hexyl-2-hydroxy-3-(phenylcarbamoyldiazenyl)indol-5-yl]sulfanylethyl]benzoic acid |
|---|---|
| PubChem CID | 135438393 |
| Molecular Formula | C30H32N4O4S |
| Molecular Weight | 544.68 g/mol |
| Exact Mass | 544.21 |
| IUPAC Name | 4-[2-[1-hexyl-2-hydroxy-3-(phenylcarbamoyldiazenyl)indol-5-yl]sulfanylethyl]benzoic acid |
| SMILES | CCCCCCn1c(O)c(/N=N/C(=O)Nc2ccccc2)c2cc(SCCc3ccc(C(=O)O)cc3)ccc21 |
| InChI | InChI=1S/C30H32N4O4S/c1-2-3-4-8-18-34-26-16-15-24(39-19-17-21-11-13-22(14-12-21)29(36)37)20-25(26)27(28(34)35)32-33-30(38)31-23-9-6-5-7-10-23/h5-7,9-16,20,35H,2-4,8,17-19H2,1H3,(H,31,38)(H,36,37)/b33-32+ |
| InChIKey | VWBGWJFJZNOZAW-ULIFNZDWSA-N |
| XLogP | 8.28 |
| TPSA | 116.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.68 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|