C26H33NO5S — CID 69373719
4-[2-(1-heptyl-3,3-dimethoxy-2-oxoindol-5-yl)sulfanylethyl]benzoic acid (PubChem CID 69373719) has the molecular formula C26H33NO5S and a molecular weight of 471.62 g/mol. Its IUPAC name is 4-[2-(1-heptyl-3,3-dimethoxy-2-oxoindol-5-yl)sulfanylethyl]benzoic acid.
| Compound Name | 4-[2-(1-heptyl-3,3-dimethoxy-2-oxoindol-5-yl)sulfanylethyl]benzoic acid |
|---|---|
| PubChem CID | 69373719 |
| Molecular Formula | C26H33NO5S |
| Molecular Weight | 471.62 g/mol |
| Exact Mass | 471.21 |
| IUPAC Name | 4-[2-(1-heptyl-3,3-dimethoxy-2-oxoindol-5-yl)sulfanylethyl]benzoic acid |
| SMILES | CCCCCCCN1C(=O)C(OC)(OC)c2cc(SCCc3ccc(C(=O)O)cc3)ccc21 |
| InChI | InChI=1S/C26H33NO5S/c1-4-5-6-7-8-16-27-23-14-13-21(18-22(23)26(31-2,32-3)25(27)30)33-17-15-19-9-11-20(12-10-19)24(28)29/h9-14,18H,4-8,15-17H2,1-3H3,(H,28,29) |
| InChIKey | WHIUCKMXEXRDEA-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.62 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|