C22H25NO5S — CID 69357569
4-[2-(3,3-dimethoxy-2-oxo-1-propylindol-5-yl)sulfanylethyl]benzoic acid (PubChem CID 69357569) has the molecular formula C22H25NO5S and a molecular weight of 415.51 g/mol. Its IUPAC name is 4-[2-(3,3-dimethoxy-2-oxo-1-propylindol-5-yl)sulfanylethyl]benzoic acid.
| Compound Name | 4-[2-(3,3-dimethoxy-2-oxo-1-propylindol-5-yl)sulfanylethyl]benzoic acid |
|---|---|
| PubChem CID | 69357569 |
| Molecular Formula | C22H25NO5S |
| Molecular Weight | 415.51 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | 4-[2-(3,3-dimethoxy-2-oxo-1-propylindol-5-yl)sulfanylethyl]benzoic acid |
| SMILES | CCCN1C(=O)C(OC)(OC)c2cc(SCCc3ccc(C(=O)O)cc3)ccc21 |
| InChI | InChI=1S/C22H25NO5S/c1-4-12-23-19-10-9-17(14-18(19)22(27-2,28-3)21(23)26)29-13-11-15-5-7-16(8-6-15)20(24)25/h5-10,14H,4,11-13H2,1-3H3,(H,24,25) |
| InChIKey | BIAOKTFMZPTALD-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.51 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|