About ethyl 4-[2-(1-heptyl-3,3-dimethoxy-2-oxoindol-5-yl)sulfanylethyl]benzoate
ethyl 4-[2-(1-heptyl-3,3-dimethoxy-2-oxoindol-5-yl)sulfanylethyl]benzoate (PubChem CID 69315375) has the molecular formula C28H37NO5S
and a molecular weight of 499.67 g/mol. Its IUPAC name is ethyl 4-[2-(1-heptyl-3,3-dimethoxy-2-oxoindol-5-yl)sulfanylethyl]benzoate.
Molecular Properties
| Compound Name | ethyl 4-[2-(1-heptyl-3,3-dimethoxy-2-oxoindol-5-yl)sulfanylethyl]benzoate |
| PubChem CID | 69315375 |
| Molecular Formula | C28H37NO5S |
| Molecular Weight | 499.67 g/mol |
| Exact Mass | 499.24 |
| IUPAC Name | ethyl 4-[2-(1-heptyl-3,3-dimethoxy-2-oxoindol-5-yl)sulfanylethyl]benzoate |
| SMILES | CCCCCCCN1C(=O)C(OC)(OC)c2cc(SCCc3ccc(C(=O)OCC)cc3)ccc21 |
| InChI | InChI=1S/C28H37NO5S/c1-5-7-8-9-10-18-29-25-16-15-23(20-24(25)28(32-3,33-4)27(29)31)35-19-17-21-11-13-22(14-12-21)26(30)34-6-2/h11-16,20H,5-10,17-19H2,1-4H3 |
| InChIKey | MLWYGVGWGTWBFO-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 499.67 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-[2-(1-heptyl-3,3-dimethoxy-2-oxoindol-5-yl)sulfanylethyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[2-(1-heptyl-3,3-dimethoxy-2-oxoindol-5-yl)sulfanylethyl]benzoate?
The IUPAC name of ethyl 4-[2-(1-heptyl-3,3-dimethoxy-2-oxoindol-5-yl)sulfanylethyl]benzoate (CID 69315375) is ethyl 4-[2-(1-heptyl-3,3-dimethoxy-2-oxoindol-5-yl)sulfanylethyl]benzoate.
What is the SMILES notation for ethyl 4-[2-(1-heptyl-3,3-dimethoxy-2-oxoindol-5-yl)sulfanylethyl]benzoate?
The canonical SMILES for ethyl 4-[2-(1-heptyl-3,3-dimethoxy-2-oxoindol-5-yl)sulfanylethyl]benzoate is CCCCCCCN1C(=O)C(OC)(OC)c2cc(SCCc3ccc(C(=O)OCC)cc3)ccc21.
What is the InChIKey of ethyl 4-[2-(1-heptyl-3,3-dimethoxy-2-oxoindol-5-yl)sulfanylethyl]benzoate?
The InChIKey is MLWYGVGWGTWBFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H37NO5S/c1-5-7-8-9-10-18-29-25-16-15-23(20-24(25)28(32-3,33-4)27(29)31)35-19-17-21-11-13-22(14-12-21)26(30)34-6-2/h11-16,20H,5-10,17-19H2,1-4H3.
What are the key properties of ethyl 4-[2-(1-heptyl-3,3-dimethoxy-2-oxoindol-5-yl)sulfanylethyl]benzoate?
ethyl 4-[2-(1-heptyl-3,3-dimethoxy-2-oxoindol-5-yl)sulfanylethyl]benzoate has a molecular weight of 499.67 g/mol, XLogP of 5.96, 14 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[2-(1-heptyl-3,3-dimethoxy-2-oxoindol-5-yl)sulfanylethyl]benzoate is sourced from PubChem (CID 69315375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).