C28H37NO5S — CID 69315375
ethyl 4-[2-(1-heptyl-3,3-dimethoxy-2-oxoindol-5-yl)sulfanylethyl]benzoate (PubChem CID 69315375) has the molecular formula C28H37NO5S and a molecular weight of 499.67 g/mol. Its IUPAC name is ethyl 4-[2-(1-heptyl-3,3-dimethoxy-2-oxoindol-5-yl)sulfanylethyl]benzoate.
| Compound Name | ethyl 4-[2-(1-heptyl-3,3-dimethoxy-2-oxoindol-5-yl)sulfanylethyl]benzoate |
|---|---|
| PubChem CID | 69315375 |
| Molecular Formula | C28H37NO5S |
| Molecular Weight | 499.67 g/mol |
| Exact Mass | 499.24 |
| IUPAC Name | ethyl 4-[2-(1-heptyl-3,3-dimethoxy-2-oxoindol-5-yl)sulfanylethyl]benzoate |
| SMILES | CCCCCCCN1C(=O)C(OC)(OC)c2cc(SCCc3ccc(C(=O)OCC)cc3)ccc21 |
| InChI | InChI=1S/C28H37NO5S/c1-5-7-8-9-10-18-29-25-16-15-23(20-24(25)28(32-3,33-4)27(29)31)35-19-17-21-11-13-22(14-12-21)26(30)34-6-2/h11-16,20H,5-10,17-19H2,1-4H3 |
| InChIKey | MLWYGVGWGTWBFO-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.67 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|