C18H22N2O5 — CID 166441636
tert-butyl N-(3,3-dimethoxy-2-oxo-1-prop-2-ynylindol-5-yl)carbamate (PubChem CID 166441636) has the molecular formula C18H22N2O5 and a molecular weight of 346.38 g/mol. Its IUPAC name is tert-butyl N-(3,3-dimethoxy-2-oxo-1-prop-2-ynylindol-5-yl)carbamate.
| Compound Name | tert-butyl N-(3,3-dimethoxy-2-oxo-1-prop-2-ynylindol-5-yl)carbamate |
|---|---|
| PubChem CID | 166441636 |
| Molecular Formula | C18H22N2O5 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | tert-butyl N-(3,3-dimethoxy-2-oxo-1-prop-2-ynylindol-5-yl)carbamate |
| SMILES | C#CCN1C(=O)C(OC)(OC)c2cc(NC(=O)OC(C)(C)C)ccc21 |
| InChI | InChI=1S/C18H22N2O5/c1-7-10-20-14-9-8-12(19-16(22)25-17(2,3)4)11-13(14)18(23-5,24-6)15(20)21/h1,8-9,11H,10H2,2-6H3,(H,19,22) |
| InChIKey | FYRCLNFRVDOGQE-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|