C16H21NO4 — CID 82025318
4-heptyl-3-oxo-1,4-benzoxazine-7-carboxylic acid (PubChem CID 82025318) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is 4-heptyl-3-oxo-1,4-benzoxazine-7-carboxylic acid.
| Compound Name | 4-heptyl-3-oxo-1,4-benzoxazine-7-carboxylic acid |
|---|---|
| PubChem CID | 82025318 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 4-heptyl-3-oxo-1,4-benzoxazine-7-carboxylic acid |
| SMILES | CCCCCCCN1C(=O)COc2cc(C(=O)O)ccc21 |
| InChI | InChI=1S/C16H21NO4/c1-2-3-4-5-6-9-17-13-8-7-12(16(19)20)10-14(13)21-11-15(17)18/h7-8,10H,2-6,9,11H2,1H3,(H,19,20) |
| InChIKey | IOVJFGPDYISMEG-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|