C20H19BrClN3O2 — CID 135726463
N-(5-bromo-2-hydroxy-1-pentylindol-3-yl)imino-2-chlorobenzamide (PubChem CID 135726463) has the molecular formula C20H19BrClN3O2 and a molecular weight of 448.75 g/mol. Its IUPAC name is N-(5-bromo-2-hydroxy-1-pentylindol-3-yl)imino-2-chlorobenzamide.
| Compound Name | N-(5-bromo-2-hydroxy-1-pentylindol-3-yl)imino-2-chlorobenzamide |
|---|---|
| PubChem CID | 135726463 |
| Molecular Formula | C20H19BrClN3O2 |
| Molecular Weight | 448.75 g/mol |
| Exact Mass | 447.03 |
| IUPAC Name | N-(5-bromo-2-hydroxy-1-pentylindol-3-yl)imino-2-chlorobenzamide |
| SMILES | CCCCCn1c(O)c(/N=N/C(=O)c2ccccc2Cl)c2cc(Br)ccc21 |
| InChI | InChI=1S/C20H19BrClN3O2/c1-2-3-6-11-25-17-10-9-13(21)12-15(17)18(20(25)27)23-24-19(26)14-7-4-5-8-16(14)22/h4-5,7-10,12,27H,2-3,6,11H2,1H3/b24-23+ |
| InChIKey | PQXYASPSCHAKOL-WCWDXBQESA-N |
| XLogP | 6.88 |
| TPSA | 66.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.75 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|