C19H19BrN4O3 — CID 3366985
N-[5-bromo-1-[(dimethylamino)methyl]-2-hydroxyindol-3-yl]imino-2-methoxybenzamide (PubChem CID 3366985) has the molecular formula C19H19BrN4O3 and a molecular weight of 431.29 g/mol. Its IUPAC name is N-[5-bromo-1-[(dimethylamino)methyl]-2-hydroxyindol-3-yl]imino-2-methoxybenzamide.
| Compound Name | N-[5-bromo-1-[(dimethylamino)methyl]-2-hydroxyindol-3-yl]imino-2-methoxybenzamide |
|---|---|
| PubChem CID | 3366985 |
| Molecular Formula | C19H19BrN4O3 |
| Molecular Weight | 431.29 g/mol |
| Exact Mass | 430.06 |
| IUPAC Name | N-[5-bromo-1-[(dimethylamino)methyl]-2-hydroxyindol-3-yl]imino-2-methoxybenzamide |
| SMILES | COc1ccccc1C(=O)/N=N/c1c(O)n(CN(C)C)c2ccc(Br)cc12 |
| InChI | InChI=1S/C19H19BrN4O3/c1-23(2)11-24-15-9-8-12(20)10-14(15)17(19(24)26)21-22-18(25)13-6-4-5-7-16(13)27-3/h4-10,26H,11H2,1-3H3/b22-21+ |
| InChIKey | HNNXZUVTMTZPAA-QURGRASLSA-N |
| XLogP | 4.56 |
| TPSA | 79.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.29 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|