C25H23BrN4O2S — CID 3484995
1-[5-bromo-1-[(2,5-dimethylphenyl)methyl]-2-hydroxyindol-3-yl]imino-3-(2-methoxyphenyl)thiourea (PubChem CID 3484995) has the molecular formula C25H23BrN4O2S and a molecular weight of 523.46 g/mol. Its IUPAC name is 1-[5-bromo-1-[(2,5-dimethylphenyl)methyl]-2-hydroxyindol-3-yl]imino-3-(2-methoxyphenyl)thiourea.
| Compound Name | 1-[5-bromo-1-[(2,5-dimethylphenyl)methyl]-2-hydroxyindol-3-yl]imino-3-(2-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 3484995 |
| Molecular Formula | C25H23BrN4O2S |
| Molecular Weight | 523.46 g/mol |
| Exact Mass | 522.07 |
| IUPAC Name | 1-[5-bromo-1-[(2,5-dimethylphenyl)methyl]-2-hydroxyindol-3-yl]imino-3-(2-methoxyphenyl)thiourea |
| SMILES | COc1ccccc1NC(=S)/N=N/c1c(O)n(Cc2cc(C)ccc2C)c2ccc(Br)cc12 |
| InChI | InChI=1S/C25H23BrN4O2S/c1-15-8-9-16(2)17(12-15)14-30-21-11-10-18(26)13-19(21)23(24(30)31)28-29-25(33)27-20-6-4-5-7-22(20)32-3/h4-13,31H,14H2,1-3H3,(H,27,33)/b29-28+ |
| InChIKey | FEMOHMHVVTUAME-ZQHSETAFSA-N |
| XLogP | 7.26 |
| TPSA | 71.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.46 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|