C24H21ClN4O2S — CID 4124725
1-(3-chloro-4-methoxyphenyl)-3-[2-hydroxy-1-[(3-methylphenyl)methyl]indol-3-yl]iminothiourea (PubChem CID 4124725) has the molecular formula C24H21ClN4O2S and a molecular weight of 464.98 g/mol. Its IUPAC name is 1-(3-chloro-4-methoxyphenyl)-3-[2-hydroxy-1-[(3-methylphenyl)methyl]indol-3-yl]iminothiourea.
| Compound Name | 1-(3-chloro-4-methoxyphenyl)-3-[2-hydroxy-1-[(3-methylphenyl)methyl]indol-3-yl]iminothiourea |
|---|---|
| PubChem CID | 4124725 |
| Molecular Formula | C24H21ClN4O2S |
| Molecular Weight | 464.98 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | 1-(3-chloro-4-methoxyphenyl)-3-[2-hydroxy-1-[(3-methylphenyl)methyl]indol-3-yl]iminothiourea |
| SMILES | COc1ccc(NC(=S)/N=N/c2c(O)n(Cc3cccc(C)c3)c3ccccc23)cc1Cl |
| InChI | InChI=1S/C24H21ClN4O2S/c1-15-6-5-7-16(12-15)14-29-20-9-4-3-8-18(20)22(23(29)30)27-28-24(32)26-17-10-11-21(31-2)19(25)13-17/h3-13,30H,14H2,1-2H3,(H,26,32)/b28-27+ |
| InChIKey | CNCFIXUQIGFJBN-BYYHNAKLSA-N |
| XLogP | 6.85 |
| TPSA | 71.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.98 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|