C24H21BrN4OS — CID 5128786
1-(1-benzyl-5-bromo-2-hydroxyindol-3-yl)imino-3-(3,4-dimethylphenyl)thiourea (PubChem CID 5128786) has the molecular formula C24H21BrN4OS and a molecular weight of 493.43 g/mol. Its IUPAC name is 1-(1-benzyl-5-bromo-2-hydroxyindol-3-yl)imino-3-(3,4-dimethylphenyl)thiourea.
| Compound Name | 1-(1-benzyl-5-bromo-2-hydroxyindol-3-yl)imino-3-(3,4-dimethylphenyl)thiourea |
|---|---|
| PubChem CID | 5128786 |
| Molecular Formula | C24H21BrN4OS |
| Molecular Weight | 493.43 g/mol |
| Exact Mass | 492.06 |
| IUPAC Name | 1-(1-benzyl-5-bromo-2-hydroxyindol-3-yl)imino-3-(3,4-dimethylphenyl)thiourea |
| SMILES | Cc1ccc(NC(=S)/N=N/c2c(O)n(Cc3ccccc3)c3ccc(Br)cc23)cc1C |
| InChI | InChI=1S/C24H21BrN4OS/c1-15-8-10-19(12-16(15)2)26-24(31)28-27-22-20-13-18(25)9-11-21(20)29(23(22)30)14-17-6-4-3-5-7-17/h3-13,30H,14H2,1-2H3,(H,26,31)/b28-27+ |
| InChIKey | YLSXUMQWLMRIFU-BYYHNAKLSA-N |
| XLogP | 7.26 |
| TPSA | 61.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.43 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|