C25H23ClN4OS — CID 4116966
1-[1-[(4-chlorophenyl)methyl]-2-hydroxyindol-3-yl]imino-3-(2,4,6-trimethylphenyl)thiourea (PubChem CID 4116966) has the molecular formula C25H23ClN4OS and a molecular weight of 463.01 g/mol. Its IUPAC name is 1-[1-[(4-chlorophenyl)methyl]-2-hydroxyindol-3-yl]imino-3-(2,4,6-trimethylphenyl)thiourea.
| Compound Name | 1-[1-[(4-chlorophenyl)methyl]-2-hydroxyindol-3-yl]imino-3-(2,4,6-trimethylphenyl)thiourea |
|---|---|
| PubChem CID | 4116966 |
| Molecular Formula | C25H23ClN4OS |
| Molecular Weight | 463.01 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | 1-[1-[(4-chlorophenyl)methyl]-2-hydroxyindol-3-yl]imino-3-(2,4,6-trimethylphenyl)thiourea |
| SMILES | Cc1cc(C)c(NC(=S)/N=N/c2c(O)n(Cc3ccc(Cl)cc3)c3ccccc23)c(C)c1 |
| InChI | InChI=1S/C25H23ClN4OS/c1-15-12-16(2)22(17(3)13-15)27-25(32)29-28-23-20-6-4-5-7-21(20)30(24(23)31)14-18-8-10-19(26)11-9-18/h4-13,31H,14H2,1-3H3,(H,27,32)/b29-28+ |
| InChIKey | ACHVQJGJCHDDOD-ZQHSETAFSA-N |
| XLogP | 7.45 |
| TPSA | 61.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.01 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|