C19H18N4OS — CID 3362907
1-(1-benzyl-2-hydroxyindol-3-yl)imino-3-prop-2-enylthiourea (PubChem CID 3362907) has the molecular formula C19H18N4OS and a molecular weight of 350.45 g/mol. Its IUPAC name is 1-(1-benzyl-2-hydroxyindol-3-yl)imino-3-prop-2-enylthiourea.
| Compound Name | 1-(1-benzyl-2-hydroxyindol-3-yl)imino-3-prop-2-enylthiourea |
|---|---|
| PubChem CID | 3362907 |
| Molecular Formula | C19H18N4OS |
| Molecular Weight | 350.45 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 1-(1-benzyl-2-hydroxyindol-3-yl)imino-3-prop-2-enylthiourea |
| SMILES | C=CCNC(=S)/N=N/c1c(O)n(Cc2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C19H18N4OS/c1-2-12-20-19(25)22-21-17-15-10-6-7-11-16(15)23(18(17)24)13-14-8-4-3-5-9-14/h2-11,24H,1,12-13H2,(H,20,25)/b22-21+ |
| InChIKey | CNRTTXQNDDLGGG-QURGRASLSA-N |
| XLogP | 4.54 |
| TPSA | 61.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.45 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|