C21H14Cl3N3O — CID 4989962
1-benzyl-3-[(2,4,6-trichlorophenyl)diazenyl]indol-2-ol (PubChem CID 4989962) has the molecular formula C21H14Cl3N3O and a molecular weight of 430.72 g/mol. Its IUPAC name is 1-benzyl-3-[(2,4,6-trichlorophenyl)diazenyl]indol-2-ol.
| Compound Name | 1-benzyl-3-[(2,4,6-trichlorophenyl)diazenyl]indol-2-ol |
|---|---|
| PubChem CID | 4989962 |
| Molecular Formula | C21H14Cl3N3O |
| Molecular Weight | 430.72 g/mol |
| Exact Mass | 429.02 |
| IUPAC Name | 1-benzyl-3-[(2,4,6-trichlorophenyl)diazenyl]indol-2-ol |
| SMILES | Oc1c(/N=N/c2c(Cl)cc(Cl)cc2Cl)c2ccccc2n1Cc1ccccc1 |
| InChI | InChI=1S/C21H14Cl3N3O/c22-14-10-16(23)20(17(24)11-14)26-25-19-15-8-4-5-9-18(15)27(21(19)28)12-13-6-2-1-3-7-13/h1-11,28H,12H2/b26-25+ |
| InChIKey | LZEFSGMEDACULH-OCEACIFDSA-N |
| XLogP | 7.77 |
| TPSA | 49.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.72 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|