C21H23N4O+ — CID 135852419
1-benzyl-3-(3,4,5,6-tetrahydro-2H-azepin-1-ium-7-yldiazenyl)indol-2-ol (PubChem CID 135852419) has the molecular formula C21H23N4O+ and a molecular weight of 347.44 g/mol. Its IUPAC name is 1-benzyl-3-(3,4,5,6-tetrahydro-2H-azepin-1-ium-7-yldiazenyl)indol-2-ol.
| Compound Name | 1-benzyl-3-(3,4,5,6-tetrahydro-2H-azepin-1-ium-7-yldiazenyl)indol-2-ol |
|---|---|
| PubChem CID | 135852419 |
| Molecular Formula | C21H23N4O+ |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | 1-benzyl-3-(3,4,5,6-tetrahydro-2H-azepin-1-ium-7-yldiazenyl)indol-2-ol |
| SMILES | Oc1c(/N=N/C2=[NH+]CCCCC2)c2ccccc2n1Cc1ccccc1 |
| InChI | InChI=1S/C21H22N4O/c26-21-20(24-23-19-13-5-2-8-14-22-19)17-11-6-7-12-18(17)25(21)15-16-9-3-1-4-10-16/h1,3-4,6-7,9-12,26H,2,5,8,13-15H2/p+1/b24-23+ |
| InChIKey | DMVLOVWPIOPJTG-WCWDXBQESA-O |
| XLogP | 3.53 |
| TPSA | 63.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|