C29H29N3O2 — CID 135913127
trans-(1S,2S)-N-(1-benzyl-2-hydroxyindol-3-yl)imino-2-(4-tert-butylphenyl)cyclopropane-1-carboxamide (PubChem CID 135913127) has the molecular formula C29H29N3O2 and a molecular weight of 451.57 g/mol. Its IUPAC name is trans-(1S,2S)-N-(1-benzyl-2-hydroxyindol-3-yl)imino-2-(4-tert-butylphenyl)cyclopropane-1-carboxamide.
| Compound Name | trans-(1S,2S)-N-(1-benzyl-2-hydroxyindol-3-yl)imino-2-(4-tert-butylphenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 135913127 |
| Molecular Formula | C29H29N3O2 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.23 |
| IUPAC Name | trans-(1S,2S)-N-(1-benzyl-2-hydroxyindol-3-yl)imino-2-(4-tert-butylphenyl)cyclopropane-1-carboxamide |
| SMILES | CC(C)(C)c1ccc([C@H]2C[C@@H]2C(=O)/N=N/c2c(O)n(Cc3ccccc3)c3ccccc23)cc1 |
| InChI | InChI=1S/C29H29N3O2/c1-29(2,3)21-15-13-20(14-16-21)23-17-24(23)27(33)31-30-26-22-11-7-8-12-25(22)32(28(26)34)18-19-9-5-4-6-10-19/h4-16,23-24,34H,17-18H2,1-3H3/b31-30+/t23-,24+/m1/s1 |
| InChIKey | XMDRVUPIVUTINL-WROGGSBWSA-N |
| XLogP | 7.11 |
| TPSA | 66.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|