C29H29N3O4 — CID 1270594
(3R)-6-tert-butyl-N-[2-hydroxy-1-(2-phenylethyl)indol-3-yl]imino-2,3-dihydro-1,4-benzodioxine-3-carboxamide (PubChem CID 1270594) has the molecular formula C29H29N3O4 and a molecular weight of 483.57 g/mol. Its IUPAC name is (3R)-6-tert-butyl-N-[2-hydroxy-1-(2-phenylethyl)indol-3-yl]imino-2,3-dihydro-1,4-benzodioxine-3-carboxamide.
| Compound Name | (3R)-6-tert-butyl-N-[2-hydroxy-1-(2-phenylethyl)indol-3-yl]imino-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
|---|---|
| PubChem CID | 1270594 |
| Molecular Formula | C29H29N3O4 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.22 |
| IUPAC Name | (3R)-6-tert-butyl-N-[2-hydroxy-1-(2-phenylethyl)indol-3-yl]imino-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
| SMILES | CC(C)(C)c1ccc2c(c1)O[C@@H](C(=O)/N=N/c1c(O)n(CCc3ccccc3)c3ccccc13)CO2 |
| InChI | InChI=1S/C29H29N3O4/c1-29(2,3)20-13-14-23-24(17-20)36-25(18-35-23)27(33)31-30-26-21-11-7-8-12-22(21)32(28(26)34)16-15-19-9-5-4-6-10-19/h4-14,17,25,34H,15-16,18H2,1-3H3/b31-30+/t25-/m1/s1 |
| InChIKey | XMAWHTMDHOCVLZ-RRTGGRSNSA-N |
| XLogP | 6.34 |
| TPSA | 85.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|