C24H18ClN3O4 — CID 4210172
N-[1-[(2-chlorophenyl)methyl]-2-hydroxyindol-3-yl]imino-2,3-dihydro-1,4-benzodioxine-3-carboxamide (PubChem CID 4210172) has the molecular formula C24H18ClN3O4 and a molecular weight of 447.88 g/mol. Its IUPAC name is N-[1-[(2-chlorophenyl)methyl]-2-hydroxyindol-3-yl]imino-2,3-dihydro-1,4-benzodioxine-3-carboxamide.
| Compound Name | N-[1-[(2-chlorophenyl)methyl]-2-hydroxyindol-3-yl]imino-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
|---|---|
| PubChem CID | 4210172 |
| Molecular Formula | C24H18ClN3O4 |
| Molecular Weight | 447.88 g/mol |
| Exact Mass | 447.10 |
| IUPAC Name | N-[1-[(2-chlorophenyl)methyl]-2-hydroxyindol-3-yl]imino-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
| SMILES | O=C(/N=N/c1c(O)n(Cc2ccccc2Cl)c2ccccc12)C1COc2ccccc2O1 |
| InChI | InChI=1S/C24H18ClN3O4/c25-17-9-3-1-7-15(17)13-28-18-10-4-2-8-16(18)22(24(28)30)26-27-23(29)21-14-31-19-11-5-6-12-20(19)32-21/h1-12,21,30H,13-14H2/b27-26+ |
| InChIKey | DSOXUCUVWIMIDG-CYYJNZCTSA-N |
| XLogP | 5.50 |
| TPSA | 85.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.88 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|