C26H21ClN4O5 — CID 1391208
(3R)-N-[2-[[1-[(2-chlorophenyl)methyl]-2-hydroxyindol-3-yl]diazenyl]-2-oxoethyl]-2,3-dihydro-1,4-benzodioxine-3-carboxamide (PubChem CID 1391208) has the molecular formula C26H21ClN4O5 and a molecular weight of 504.93 g/mol. Its IUPAC name is (3R)-N-[2-[[1-[(2-chlorophenyl)methyl]-2-hydroxyindol-3-yl]diazenyl]-2-oxoethyl]-2,3-dihydro-1,4-benzodioxine-3-carboxamide.
| Compound Name | (3R)-N-[2-[[1-[(2-chlorophenyl)methyl]-2-hydroxyindol-3-yl]diazenyl]-2-oxoethyl]-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
|---|---|
| PubChem CID | 1391208 |
| Molecular Formula | C26H21ClN4O5 |
| Molecular Weight | 504.93 g/mol |
| Exact Mass | 504.12 |
| IUPAC Name | (3R)-N-[2-[[1-[(2-chlorophenyl)methyl]-2-hydroxyindol-3-yl]diazenyl]-2-oxoethyl]-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
| SMILES | O=C(CNC(=O)[C@H]1COc2ccccc2O1)/N=N/c1c(O)n(Cc2ccccc2Cl)c2ccccc12 |
| InChI | InChI=1S/C26H21ClN4O5/c27-18-9-3-1-7-16(18)14-31-19-10-4-2-8-17(19)24(26(31)34)30-29-23(32)13-28-25(33)22-15-35-20-11-5-6-12-21(20)36-22/h1-12,22,34H,13-15H2,(H,28,33)/b30-29+/t22-/m1/s1 |
| InChIKey | GQKQTIOWXPVVEQ-VLYIQUAWSA-N |
| XLogP | 4.62 |
| TPSA | 114.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.93 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|