C27H23ClN4O4 — CID 135526905
(E)-N-[2-[[1-[(2-chlorophenyl)methyl]-2-hydroxyindol-3-yl]diazenyl]-2-oxoethyl]-3-(4-methoxyphenyl)prop-2-enamide (PubChem CID 135526905) has the molecular formula C27H23ClN4O4 and a molecular weight of 502.96 g/mol. Its IUPAC name is (E)-N-[2-[[1-[(2-chlorophenyl)methyl]-2-hydroxyindol-3-yl]diazenyl]-2-oxoethyl]-3-(4-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[2-[[1-[(2-chlorophenyl)methyl]-2-hydroxyindol-3-yl]diazenyl]-2-oxoethyl]-3-(4-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 135526905 |
| Molecular Formula | C27H23ClN4O4 |
| Molecular Weight | 502.96 g/mol |
| Exact Mass | 502.14 |
| IUPAC Name | (E)-N-[2-[[1-[(2-chlorophenyl)methyl]-2-hydroxyindol-3-yl]diazenyl]-2-oxoethyl]-3-(4-methoxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)NCC(=O)/N=N/c2c(O)n(Cc3ccccc3Cl)c3ccccc23)cc1 |
| InChI | InChI=1S/C27H23ClN4O4/c1-36-20-13-10-18(11-14-20)12-15-24(33)29-16-25(34)30-31-26-21-7-3-5-9-23(21)32(27(26)35)17-19-6-2-4-8-22(19)28/h2-15,35H,16-17H2,1H3,(H,29,33)/b15-12+,31-30+ |
| InChIKey | ZVTFCVMZIPQPNQ-TXIORZEISA-N |
| XLogP | 5.50 |
| TPSA | 105.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.96 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|