C23H22N4O6 — CID 135648157
methyl 2-[2-hydroxy-3-[[2-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]acetyl]diazenyl]indol-1-yl]acetate (PubChem CID 135648157) has the molecular formula C23H22N4O6 and a molecular weight of 450.45 g/mol. Its IUPAC name is methyl 2-[2-hydroxy-3-[[2-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]acetyl]diazenyl]indol-1-yl]acetate.
| Compound Name | methyl 2-[2-hydroxy-3-[[2-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]acetyl]diazenyl]indol-1-yl]acetate |
|---|---|
| PubChem CID | 135648157 |
| Molecular Formula | C23H22N4O6 |
| Molecular Weight | 450.45 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | methyl 2-[2-hydroxy-3-[[2-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]acetyl]diazenyl]indol-1-yl]acetate |
| SMILES | COC(=O)Cn1c(O)c(/N=N/C(=O)CNC(=O)/C=C/c2ccc(OC)cc2)c2ccccc21 |
| InChI | InChI=1S/C23H22N4O6/c1-32-16-10-7-15(8-11-16)9-12-19(28)24-13-20(29)25-26-22-17-5-3-4-6-18(17)27(23(22)31)14-21(30)33-2/h3-12,31H,13-14H2,1-2H3,(H,24,28)/b12-9+,26-25+ |
| InChIKey | IHKNCGZJOYYNOE-ONNLIRQZSA-N |
| XLogP | 2.97 |
| TPSA | 131.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.45 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|