C22H23N3O5 — CID 135604049
methyl 2-[2-hydroxy-3-[[2-(4-propylphenoxy)acetyl]diazenyl]indol-1-yl]acetate (PubChem CID 135604049) has the molecular formula C22H23N3O5 and a molecular weight of 409.44 g/mol. Its IUPAC name is methyl 2-[2-hydroxy-3-[[2-(4-propylphenoxy)acetyl]diazenyl]indol-1-yl]acetate.
| Compound Name | methyl 2-[2-hydroxy-3-[[2-(4-propylphenoxy)acetyl]diazenyl]indol-1-yl]acetate |
|---|---|
| PubChem CID | 135604049 |
| Molecular Formula | C22H23N3O5 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | methyl 2-[2-hydroxy-3-[[2-(4-propylphenoxy)acetyl]diazenyl]indol-1-yl]acetate |
| SMILES | CCCc1ccc(OCC(=O)/N=N/c2c(O)n(CC(=O)OC)c3ccccc23)cc1 |
| InChI | InChI=1S/C22H23N3O5/c1-3-6-15-9-11-16(12-10-15)30-14-19(26)23-24-21-17-7-4-5-8-18(17)25(22(21)28)13-20(27)29-2/h4-5,7-12,28H,3,6,13-14H2,1-2H3/b24-23+ |
| InChIKey | BEXHVSDWJLLUSV-WCWDXBQESA-N |
| XLogP | 4.16 |
| TPSA | 102.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|