C25H20N6O4 — CID 3755170
methyl 2-[2-hydroxy-3-[[2-(2-pyridin-2-ylbenzimidazol-1-yl)acetyl]diazenyl]indol-1-yl]acetate (PubChem CID 3755170) has the molecular formula C25H20N6O4 and a molecular weight of 468.47 g/mol. Its IUPAC name is methyl 2-[2-hydroxy-3-[[2-(2-pyridin-2-ylbenzimidazol-1-yl)acetyl]diazenyl]indol-1-yl]acetate.
| Compound Name | methyl 2-[2-hydroxy-3-[[2-(2-pyridin-2-ylbenzimidazol-1-yl)acetyl]diazenyl]indol-1-yl]acetate |
|---|---|
| PubChem CID | 3755170 |
| Molecular Formula | C25H20N6O4 |
| Molecular Weight | 468.47 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | methyl 2-[2-hydroxy-3-[[2-(2-pyridin-2-ylbenzimidazol-1-yl)acetyl]diazenyl]indol-1-yl]acetate |
| SMILES | COC(=O)Cn1c(O)c(/N=N/C(=O)Cn2c(-c3ccccn3)nc3ccccc32)c2ccccc21 |
| InChI | InChI=1S/C25H20N6O4/c1-35-22(33)15-31-19-11-4-2-8-16(19)23(25(31)34)29-28-21(32)14-30-20-12-5-3-9-17(20)27-24(30)18-10-6-7-13-26-18/h2-13,34H,14-15H2,1H3/b29-28+ |
| InChIKey | YMJFEXZPCKEQAK-ZQHSETAFSA-N |
| XLogP | 4.24 |
| TPSA | 123.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.47 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|