C18H16N4O4 — CID 1365560
ethyl 2-[2-hydroxy-3-(pyridine-2-carbonyldiazenyl)indol-1-yl]acetate (PubChem CID 1365560) has the molecular formula C18H16N4O4 and a molecular weight of 352.35 g/mol. Its IUPAC name is ethyl 2-[2-hydroxy-3-(pyridine-2-carbonyldiazenyl)indol-1-yl]acetate.
| Compound Name | ethyl 2-[2-hydroxy-3-(pyridine-2-carbonyldiazenyl)indol-1-yl]acetate |
|---|---|
| PubChem CID | 1365560 |
| Molecular Formula | C18H16N4O4 |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | ethyl 2-[2-hydroxy-3-(pyridine-2-carbonyldiazenyl)indol-1-yl]acetate |
| SMILES | CCOC(=O)Cn1c(O)c(/N=N/C(=O)c2ccccn2)c2ccccc21 |
| InChI | InChI=1S/C18H16N4O4/c1-2-26-15(23)11-22-14-9-4-3-7-12(14)16(18(22)25)20-21-17(24)13-8-5-6-10-19-13/h3-10,25H,2,11H2,1H3/b21-20+ |
| InChIKey | VPCJTHWTMMEYJD-QZQOTICOSA-N |
| XLogP | 3.23 |
| TPSA | 106.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|