C21H23N5O2 — CID 2024237
N-[1-(azepan-1-ylmethyl)-2-hydroxyindol-3-yl]iminopyridine-2-carboxamide (PubChem CID 2024237) has the molecular formula C21H23N5O2 and a molecular weight of 377.45 g/mol. Its IUPAC name is N-[1-(azepan-1-ylmethyl)-2-hydroxyindol-3-yl]iminopyridine-2-carboxamide.
| Compound Name | N-[1-(azepan-1-ylmethyl)-2-hydroxyindol-3-yl]iminopyridine-2-carboxamide |
|---|---|
| PubChem CID | 2024237 |
| Molecular Formula | C21H23N5O2 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | N-[1-(azepan-1-ylmethyl)-2-hydroxyindol-3-yl]iminopyridine-2-carboxamide |
| SMILES | O=C(/N=N/c1c(O)n(CN2CCCCCC2)c2ccccc12)c1ccccn1 |
| InChI | InChI=1S/C21H23N5O2/c27-20(17-10-5-6-12-22-17)24-23-19-16-9-3-4-11-18(16)26(21(19)28)15-25-13-7-1-2-8-14-25/h3-6,9-12,28H,1-2,7-8,13-15H2/b24-23+ |
| InChIKey | PBSZRTMKFJYSHU-WCWDXBQESA-N |
| XLogP | 4.50 |
| TPSA | 83.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|