C24H27N5O4 — CID 135537774
2-(4-acetamidophenoxy)-N-[2-hydroxy-1-(piperidin-1-ylmethyl)indol-3-yl]iminoacetamide (PubChem CID 135537774) has the molecular formula C24H27N5O4 and a molecular weight of 449.51 g/mol. Its IUPAC name is 2-(4-acetamidophenoxy)-N-[2-hydroxy-1-(piperidin-1-ylmethyl)indol-3-yl]iminoacetamide.
| Compound Name | 2-(4-acetamidophenoxy)-N-[2-hydroxy-1-(piperidin-1-ylmethyl)indol-3-yl]iminoacetamide |
|---|---|
| PubChem CID | 135537774 |
| Molecular Formula | C24H27N5O4 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | 2-(4-acetamidophenoxy)-N-[2-hydroxy-1-(piperidin-1-ylmethyl)indol-3-yl]iminoacetamide |
| SMILES | CC(=O)Nc1ccc(OCC(=O)/N=N/c2c(O)n(CN3CCCCC3)c3ccccc23)cc1 |
| InChI | InChI=1S/C24H27N5O4/c1-17(30)25-18-9-11-19(12-10-18)33-15-22(31)26-27-23-20-7-3-4-8-21(20)29(24(23)32)16-28-13-5-2-6-14-28/h3-4,7-12,32H,2,5-6,13-16H2,1H3,(H,25,30)/b27-26+ |
| InChIKey | KCTTWJKTZQPPHK-CYYJNZCTSA-N |
| XLogP | 4.44 |
| TPSA | 108.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|