C20H23N4O3+ — CID 135848863
[2-hydroxy-3-[[2-(4-methylphenoxy)acetyl]diazenyl]indol-1-yl]methyl-dimethylazanium (PubChem CID 135848863) has the molecular formula C20H23N4O3+ and a molecular weight of 367.43 g/mol. Its IUPAC name is [2-hydroxy-3-[[2-(4-methylphenoxy)acetyl]diazenyl]indol-1-yl]methyl-dimethylazanium.
| Compound Name | [2-hydroxy-3-[[2-(4-methylphenoxy)acetyl]diazenyl]indol-1-yl]methyl-dimethylazanium |
|---|---|
| PubChem CID | 135848863 |
| Molecular Formula | C20H23N4O3+ |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | [2-hydroxy-3-[[2-(4-methylphenoxy)acetyl]diazenyl]indol-1-yl]methyl-dimethylazanium |
| SMILES | Cc1ccc(OCC(=O)/N=N/c2c(O)n(C[NH+](C)C)c3ccccc23)cc1 |
| InChI | InChI=1S/C20H22N4O3/c1-14-8-10-15(11-9-14)27-12-18(25)21-22-19-16-6-4-5-7-17(16)24(20(19)26)13-23(2)3/h4-11,26H,12-13H2,1-3H3/p+1/b22-21+ |
| InChIKey | FQEHSZIIUSFJSZ-QURGRASLSA-O |
| XLogP | 2.45 |
| TPSA | 80.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|