C22H25N3O4 — CID 135674746
2-(3,5-dimethylphenoxy)-N-[1-(2-ethoxyethyl)-2-hydroxyindol-3-yl]iminoacetamide (PubChem CID 135674746) has the molecular formula C22H25N3O4 and a molecular weight of 395.46 g/mol. Its IUPAC name is 2-(3,5-dimethylphenoxy)-N-[1-(2-ethoxyethyl)-2-hydroxyindol-3-yl]iminoacetamide.
| Compound Name | 2-(3,5-dimethylphenoxy)-N-[1-(2-ethoxyethyl)-2-hydroxyindol-3-yl]iminoacetamide |
|---|---|
| PubChem CID | 135674746 |
| Molecular Formula | C22H25N3O4 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | 2-(3,5-dimethylphenoxy)-N-[1-(2-ethoxyethyl)-2-hydroxyindol-3-yl]iminoacetamide |
| SMILES | CCOCCn1c(O)c(/N=N/C(=O)COc2cc(C)cc(C)c2)c2ccccc21 |
| InChI | InChI=1S/C22H25N3O4/c1-4-28-10-9-25-19-8-6-5-7-18(19)21(22(25)27)24-23-20(26)14-29-17-12-15(2)11-16(3)13-17/h5-8,11-13,27H,4,9-10,14H2,1-3H3/b24-23+ |
| InChIKey | AXBRXLFLXAYELJ-WCWDXBQESA-N |
| XLogP | 4.69 |
| TPSA | 85.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|