C21H23N3O5 — CID 135710555
N-[1-(2-ethoxyethyl)-2-hydroxyindol-3-yl]imino-3,4-dimethoxybenzamide (PubChem CID 135710555) has the molecular formula C21H23N3O5 and a molecular weight of 397.43 g/mol. Its IUPAC name is N-[1-(2-ethoxyethyl)-2-hydroxyindol-3-yl]imino-3,4-dimethoxybenzamide.
| Compound Name | N-[1-(2-ethoxyethyl)-2-hydroxyindol-3-yl]imino-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 135710555 |
| Molecular Formula | C21H23N3O5 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | N-[1-(2-ethoxyethyl)-2-hydroxyindol-3-yl]imino-3,4-dimethoxybenzamide |
| SMILES | CCOCCn1c(O)c(/N=N/C(=O)c2ccc(OC)c(OC)c2)c2ccccc21 |
| InChI | InChI=1S/C21H23N3O5/c1-4-29-12-11-24-16-8-6-5-7-15(16)19(21(24)26)22-23-20(25)14-9-10-17(27-2)18(13-14)28-3/h5-10,13,26H,4,11-12H2,1-3H3/b23-22+ |
| InChIKey | AXFVWMZMKKULNB-GHVJWSGMSA-N |
| XLogP | 4.32 |
| TPSA | 94.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|