C20H19N3O5 — CID 135784384
ethyl 2-[2-hydroxy-3-[(4-methoxybenzoyl)diazenyl]indol-1-yl]acetate (PubChem CID 135784384) has the molecular formula C20H19N3O5 and a molecular weight of 381.39 g/mol. Its IUPAC name is ethyl 2-[2-hydroxy-3-[(4-methoxybenzoyl)diazenyl]indol-1-yl]acetate.
| Compound Name | ethyl 2-[2-hydroxy-3-[(4-methoxybenzoyl)diazenyl]indol-1-yl]acetate |
|---|---|
| PubChem CID | 135784384 |
| Molecular Formula | C20H19N3O5 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | ethyl 2-[2-hydroxy-3-[(4-methoxybenzoyl)diazenyl]indol-1-yl]acetate |
| SMILES | CCOC(=O)Cn1c(O)c(/N=N/C(=O)c2ccc(OC)cc2)c2ccccc21 |
| InChI | InChI=1S/C20H19N3O5/c1-3-28-17(24)12-23-16-7-5-4-6-15(16)18(20(23)26)21-22-19(25)13-8-10-14(27-2)11-9-13/h4-11,26H,3,12H2,1-2H3/b22-21+ |
| InChIKey | SQGYNUIYQPSRSM-QURGRASLSA-N |
| XLogP | 3.84 |
| TPSA | 102.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|