C24H26N4O8 — CID 3661340
ethyl 2-[2-hydroxy-3-[[2-[(3,4,5-trimethoxybenzoyl)amino]acetyl]diazenyl]indol-1-yl]acetate (PubChem CID 3661340) has the molecular formula C24H26N4O8 and a molecular weight of 498.49 g/mol. Its IUPAC name is ethyl 2-[2-hydroxy-3-[[2-[(3,4,5-trimethoxybenzoyl)amino]acetyl]diazenyl]indol-1-yl]acetate.
| Compound Name | ethyl 2-[2-hydroxy-3-[[2-[(3,4,5-trimethoxybenzoyl)amino]acetyl]diazenyl]indol-1-yl]acetate |
|---|---|
| PubChem CID | 3661340 |
| Molecular Formula | C24H26N4O8 |
| Molecular Weight | 498.49 g/mol |
| Exact Mass | 498.18 |
| IUPAC Name | ethyl 2-[2-hydroxy-3-[[2-[(3,4,5-trimethoxybenzoyl)amino]acetyl]diazenyl]indol-1-yl]acetate |
| SMILES | CCOC(=O)Cn1c(O)c(/N=N/C(=O)CNC(=O)c2cc(OC)c(OC)c(OC)c2)c2ccccc21 |
| InChI | InChI=1S/C24H26N4O8/c1-5-36-20(30)13-28-16-9-7-6-8-15(16)21(24(28)32)27-26-19(29)12-25-23(31)14-10-17(33-2)22(35-4)18(11-14)34-3/h6-11,32H,5,12-13H2,1-4H3,(H,25,31)/b27-26+ |
| InChIKey | MXCSROXNVCAVKF-CYYJNZCTSA-N |
| XLogP | 2.98 |
| TPSA | 150.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.49 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|