C22H22N4O6 — CID 1417278
methyl 2-[3-[[2-[(4-ethoxybenzoyl)amino]acetyl]diazenyl]-2-hydroxyindol-1-yl]acetate (PubChem CID 1417278) has the molecular formula C22H22N4O6 and a molecular weight of 438.44 g/mol. Its IUPAC name is methyl 2-[3-[[2-[(4-ethoxybenzoyl)amino]acetyl]diazenyl]-2-hydroxyindol-1-yl]acetate.
| Compound Name | methyl 2-[3-[[2-[(4-ethoxybenzoyl)amino]acetyl]diazenyl]-2-hydroxyindol-1-yl]acetate |
|---|---|
| PubChem CID | 1417278 |
| Molecular Formula | C22H22N4O6 |
| Molecular Weight | 438.44 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | methyl 2-[3-[[2-[(4-ethoxybenzoyl)amino]acetyl]diazenyl]-2-hydroxyindol-1-yl]acetate |
| SMILES | CCOc1ccc(C(=O)NCC(=O)/N=N/c2c(O)n(CC(=O)OC)c3ccccc23)cc1 |
| InChI | InChI=1S/C22H22N4O6/c1-3-32-15-10-8-14(9-11-15)21(29)23-12-18(27)24-25-20-16-6-4-5-7-17(16)26(22(20)30)13-19(28)31-2/h4-11,30H,3,12-13H2,1-2H3,(H,23,29)/b25-24+ |
| InChIKey | LTHVCFZELQCNBK-OCOZRVBESA-N |
| XLogP | 2.96 |
| TPSA | 131.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.44 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|