C13H13N3O5 — CID 932258
methyl 2-[2-hydroxy-3-(methoxycarbonyldiazenyl)indol-1-yl]acetate (PubChem CID 932258) has the molecular formula C13H13N3O5 and a molecular weight of 291.26 g/mol. Its IUPAC name is methyl 2-[2-hydroxy-3-(methoxycarbonyldiazenyl)indol-1-yl]acetate.
| Compound Name | methyl 2-[2-hydroxy-3-(methoxycarbonyldiazenyl)indol-1-yl]acetate |
|---|---|
| PubChem CID | 932258 |
| Molecular Formula | C13H13N3O5 |
| Molecular Weight | 291.26 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | methyl 2-[2-hydroxy-3-(methoxycarbonyldiazenyl)indol-1-yl]acetate |
| SMILES | COC(=O)Cn1c(O)c(/N=N/C(=O)OC)c2ccccc21 |
| InChI | InChI=1S/C13H13N3O5/c1-20-10(17)7-16-9-6-4-3-5-8(9)11(12(16)18)14-15-13(19)21-2/h3-6,18H,7H2,1-2H3/b15-14+ |
| InChIKey | XKRFJLAGDIVXIJ-CCEZHUSRSA-N |
| XLogP | 2.37 |
| TPSA | 102.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.26 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|