C27H32N4O3 — CID 136886928
N-[2-hydroxy-1-[[(1R,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]methyl]indol-3-yl]imino-4-methoxybenzamide (PubChem CID 136886928) has the molecular formula C27H32N4O3 and a molecular weight of 460.58 g/mol. Its IUPAC name is N-[2-hydroxy-1-[[(1R,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]methyl]indol-3-yl]imino-4-methoxybenzamide.
| Compound Name | N-[2-hydroxy-1-[[(1R,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]methyl]indol-3-yl]imino-4-methoxybenzamide |
|---|---|
| PubChem CID | 136886928 |
| Molecular Formula | C27H32N4O3 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | N-[2-hydroxy-1-[[(1R,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]methyl]indol-3-yl]imino-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)/N=N/c2c(O)n(CN3C[C@@]4(C)C[C@H]3CC(C)(C)C4)c3ccccc23)cc1 |
| InChI | InChI=1S/C27H32N4O3/c1-26(2)13-19-14-27(3,15-26)16-30(19)17-31-22-8-6-5-7-21(22)23(25(31)33)28-29-24(32)18-9-11-20(34-4)12-10-18/h5-12,19,33H,13-17H2,1-4H3/b29-28+/t19-,27+/m1/s1 |
| InChIKey | AJQXLYIBRJLTJG-LNZQVZBISA-N |
| XLogP | 6.14 |
| TPSA | 79.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|