C26H28BrFN4O2 — CID 136824867
N-[5-bromo-2-hydroxy-1-[[(1R,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]methyl]indol-3-yl]imino-4-fluorobenzamide (PubChem CID 136824867) has the molecular formula C26H28BrFN4O2 and a molecular weight of 527.44 g/mol. Its IUPAC name is N-[5-bromo-2-hydroxy-1-[[(1R,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]methyl]indol-3-yl]imino-4-fluorobenzamide.
| Compound Name | N-[5-bromo-2-hydroxy-1-[[(1R,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]methyl]indol-3-yl]imino-4-fluorobenzamide |
|---|---|
| PubChem CID | 136824867 |
| Molecular Formula | C26H28BrFN4O2 |
| Molecular Weight | 527.44 g/mol |
| Exact Mass | 526.14 |
| IUPAC Name | N-[5-bromo-2-hydroxy-1-[[(1R,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]methyl]indol-3-yl]imino-4-fluorobenzamide |
| SMILES | CC1(C)C[C@@H]2C[C@](C)(CN2Cn2c(O)c(/N=N/C(=O)c3ccc(F)cc3)c3cc(Br)ccc32)C1 |
| InChI | InChI=1S/C26H28BrFN4O2/c1-25(2)11-19-12-26(3,13-25)14-31(19)15-32-21-9-6-17(27)10-20(21)22(24(32)34)29-30-23(33)16-4-7-18(28)8-5-16/h4-10,19,34H,11-15H2,1-3H3/b30-29+/t19-,26+/m1/s1 |
| InChIKey | QCMVDYZVJOIKAZ-NIPNNQNOSA-N |
| XLogP | 7.03 |
| TPSA | 70.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.44 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|