C31H39BrN4O3 — CID 4045573
N-[5-bromo-2-hydroxy-1-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]indol-3-yl]imino-2-(4-tert-butylphenoxy)acetamide (PubChem CID 4045573) has the molecular formula C31H39BrN4O3 and a molecular weight of 595.58 g/mol. Its IUPAC name is N-[5-bromo-2-hydroxy-1-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]indol-3-yl]imino-2-(4-tert-butylphenoxy)acetamide.
| Compound Name | N-[5-bromo-2-hydroxy-1-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]indol-3-yl]imino-2-(4-tert-butylphenoxy)acetamide |
|---|---|
| PubChem CID | 4045573 |
| Molecular Formula | C31H39BrN4O3 |
| Molecular Weight | 595.58 g/mol |
| Exact Mass | 594.22 |
| IUPAC Name | N-[5-bromo-2-hydroxy-1-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]indol-3-yl]imino-2-(4-tert-butylphenoxy)acetamide |
| SMILES | CC1(C)CC2CC(C)(CN2Cn2c(O)c(/N=N/C(=O)COc3ccc(C(C)(C)C)cc3)c3cc(Br)ccc32)C1 |
| InChI | InChI=1S/C31H39BrN4O3/c1-29(2,3)20-7-10-23(11-8-20)39-16-26(37)33-34-27-24-13-21(32)9-12-25(24)36(28(27)38)19-35-18-31(6)15-22(35)14-30(4,5)17-31/h7-13,22,38H,14-19H2,1-6H3/b34-33+ |
| InChIKey | WWUQHWZAWSZDHV-JEIPZWNWSA-N |
| XLogP | 7.95 |
| TPSA | 79.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.58 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|