C30H37N5O5 — CID 136856631
2-[(Z)-(3,4-dimethoxyphenyl)methylideneamino]oxy-N-[2-hydroxy-1-[[(1S,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]methyl]indol-3-yl]iminoacetamide (PubChem CID 136856631) has the molecular formula C30H37N5O5 and a molecular weight of 547.66 g/mol. Its IUPAC name is 2-[(Z)-(3,4-dimethoxyphenyl)methylideneamino]oxy-N-[2-hydroxy-1-[[(1S,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]methyl]indol-3-yl]iminoacetamide.
| Compound Name | 2-[(Z)-(3,4-dimethoxyphenyl)methylideneamino]oxy-N-[2-hydroxy-1-[[(1S,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]methyl]indol-3-yl]iminoacetamide |
|---|---|
| PubChem CID | 136856631 |
| Molecular Formula | C30H37N5O5 |
| Molecular Weight | 547.66 g/mol |
| Exact Mass | 547.28 |
| IUPAC Name | 2-[(Z)-(3,4-dimethoxyphenyl)methylideneamino]oxy-N-[2-hydroxy-1-[[(1S,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]methyl]indol-3-yl]iminoacetamide |
| SMILES | COc1ccc(/C=N\OCC(=O)/N=N/c2c(O)n(CN3C[C@]4(C)C[C@@H]3CC(C)(C)C4)c3ccccc23)cc1OC |
| InChI | InChI=1S/C30H37N5O5/c1-29(2)13-21-14-30(3,17-29)18-34(21)19-35-23-9-7-6-8-22(23)27(28(35)37)33-32-26(36)16-40-31-15-20-10-11-24(38-4)25(12-20)39-5/h6-12,15,21,37H,13-14,16-19H2,1-5H3/b31-15-,33-32+/t21-,30+/m0/s1 |
| InChIKey | MVHGNXWZSHUJNO-ANRKAEFTSA-N |
| XLogP | 5.88 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.66 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|