C31H34N4O3 — CID 5030424
N-[2-hydroxy-1-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]indol-3-yl]imino-2-naphthalen-2-yloxyacetamide (PubChem CID 5030424) has the molecular formula C31H34N4O3 and a molecular weight of 510.64 g/mol. Its IUPAC name is N-[2-hydroxy-1-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]indol-3-yl]imino-2-naphthalen-2-yloxyacetamide.
| Compound Name | N-[2-hydroxy-1-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]indol-3-yl]imino-2-naphthalen-2-yloxyacetamide |
|---|---|
| PubChem CID | 5030424 |
| Molecular Formula | C31H34N4O3 |
| Molecular Weight | 510.64 g/mol |
| Exact Mass | 510.26 |
| IUPAC Name | N-[2-hydroxy-1-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]indol-3-yl]imino-2-naphthalen-2-yloxyacetamide |
| SMILES | CC1(C)CC2CC(C)(CN2Cn2c(O)c(/N=N/C(=O)COc3ccc4ccccc4c3)c3ccccc32)C1 |
| InChI | InChI=1S/C31H34N4O3/c1-30(2)15-23-16-31(3,18-30)19-34(23)20-35-26-11-7-6-10-25(26)28(29(35)37)33-32-27(36)17-38-24-13-12-21-8-4-5-9-22(21)14-24/h4-14,23,37H,15-20H2,1-3H3/b33-32+ |
| InChIKey | WTBOQXQPIZOCOX-ULIFNZDWSA-N |
| XLogP | 7.05 |
| TPSA | 79.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.64 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|