C26H28Br2N4O2 — CID 136824875
2-bromo-N-[5-bromo-2-hydroxy-1-[[(1R,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]methyl]indol-3-yl]iminobenzamide (PubChem CID 136824875) has the molecular formula C26H28Br2N4O2 and a molecular weight of 588.34 g/mol. Its IUPAC name is 2-bromo-N-[5-bromo-2-hydroxy-1-[[(1R,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]methyl]indol-3-yl]iminobenzamide.
| Compound Name | 2-bromo-N-[5-bromo-2-hydroxy-1-[[(1R,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]methyl]indol-3-yl]iminobenzamide |
|---|---|
| PubChem CID | 136824875 |
| Molecular Formula | C26H28Br2N4O2 |
| Molecular Weight | 588.34 g/mol |
| Exact Mass | 586.06 |
| IUPAC Name | 2-bromo-N-[5-bromo-2-hydroxy-1-[[(1R,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]methyl]indol-3-yl]iminobenzamide |
| SMILES | CC1(C)C[C@H]2C[C@](C)(CN2Cn2c(O)c(/N=N/C(=O)c3ccccc3Br)c3cc(Br)ccc32)C1 |
| InChI | InChI=1S/C26H28Br2N4O2/c1-25(2)11-17-12-26(3,13-25)14-31(17)15-32-21-9-8-16(27)10-19(21)22(24(32)34)29-30-23(33)18-6-4-5-7-20(18)28/h4-10,17,34H,11-15H2,1-3H3/b30-29+/t17-,26-/m0/s1 |
| InChIKey | JGSHXQLYBQIJHR-QPTIEVQISA-N |
| XLogP | 7.65 |
| TPSA | 70.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.34 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|