C28H33BrN4O4 — CID 136836724
N-[5-bromo-2-hydroxy-1-[[(1S,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]methyl]indol-3-yl]imino-3,4-dimethoxybenzamide (PubChem CID 136836724) has the molecular formula C28H33BrN4O4 and a molecular weight of 569.50 g/mol. Its IUPAC name is N-[5-bromo-2-hydroxy-1-[[(1S,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]methyl]indol-3-yl]imino-3,4-dimethoxybenzamide.
| Compound Name | N-[5-bromo-2-hydroxy-1-[[(1S,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]methyl]indol-3-yl]imino-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 136836724 |
| Molecular Formula | C28H33BrN4O4 |
| Molecular Weight | 569.50 g/mol |
| Exact Mass | 568.17 |
| IUPAC Name | N-[5-bromo-2-hydroxy-1-[[(1S,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]methyl]indol-3-yl]imino-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)/N=N/c2c(O)n(CN3C[C@]4(C)C[C@@H]3CC(C)(C)C4)c3ccc(Br)cc23)cc1OC |
| InChI | InChI=1S/C28H33BrN4O4/c1-27(2)12-19-13-28(3,14-27)15-32(19)16-33-21-8-7-18(29)11-20(21)24(26(33)35)30-31-25(34)17-6-9-22(36-4)23(10-17)37-5/h6-11,19,35H,12-16H2,1-5H3/b31-30+/t19-,28+/m0/s1 |
| InChIKey | AMRWYKDSUVMIBJ-JRBJDTDBSA-N |
| XLogP | 6.91 |
| TPSA | 88.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.50 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|