C26H29FN4O2 — CID 135882517
4-fluoro-N-[2-hydroxy-1-[[(1R,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]methyl]indol-3-yl]iminobenzamide (PubChem CID 135882517) has the molecular formula C26H29FN4O2 and a molecular weight of 448.54 g/mol. Its IUPAC name is 4-fluoro-N-[2-hydroxy-1-[[(1R,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]methyl]indol-3-yl]iminobenzamide.
| Compound Name | 4-fluoro-N-[2-hydroxy-1-[[(1R,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]methyl]indol-3-yl]iminobenzamide |
|---|---|
| PubChem CID | 135882517 |
| Molecular Formula | C26H29FN4O2 |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | 4-fluoro-N-[2-hydroxy-1-[[(1R,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]methyl]indol-3-yl]iminobenzamide |
| SMILES | CC1(C)C[C@H]2C[C@](C)(CN2Cn2c(O)c(/N=N/C(=O)c3ccc(F)cc3)c3ccccc32)C1 |
| InChI | InChI=1S/C26H29FN4O2/c1-25(2)12-19-13-26(3,14-25)15-30(19)16-31-21-7-5-4-6-20(21)22(24(31)33)28-29-23(32)17-8-10-18(27)11-9-17/h4-11,19,33H,12-16H2,1-3H3/b29-28+/t19-,26-/m0/s1 |
| InChIKey | MWTCQWHBBAYENM-POLGCMJTSA-N |
| XLogP | 6.27 |
| TPSA | 70.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|