C32H34N4O4S — CID 136836711
N-(1-benzyl-2-hydroxyindol-3-yl)imino-4-[[(1S,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]sulfonyl]benzamide (PubChem CID 136836711) has the molecular formula C32H34N4O4S and a molecular weight of 570.72 g/mol. Its IUPAC name is N-(1-benzyl-2-hydroxyindol-3-yl)imino-4-[[(1S,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]sulfonyl]benzamide.
| Compound Name | N-(1-benzyl-2-hydroxyindol-3-yl)imino-4-[[(1S,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]sulfonyl]benzamide |
|---|---|
| PubChem CID | 136836711 |
| Molecular Formula | C32H34N4O4S |
| Molecular Weight | 570.72 g/mol |
| Exact Mass | 570.23 |
| IUPAC Name | N-(1-benzyl-2-hydroxyindol-3-yl)imino-4-[[(1S,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]sulfonyl]benzamide |
| SMILES | CC1(C)C[C@H]2C[C@@](C)(CN2S(=O)(=O)c2ccc(C(=O)/N=N/c3c(O)n(Cc4ccccc4)c4ccccc34)cc2)C1 |
| InChI | InChI=1S/C32H34N4O4S/c1-31(2)17-24-18-32(3,20-31)21-36(24)41(39,40)25-15-13-23(14-16-25)29(37)34-33-28-26-11-7-8-12-27(26)35(30(28)38)19-22-9-5-4-6-10-22/h4-16,24,38H,17-21H2,1-3H3/b34-33+/t24-,32+/m0/s1 |
| InChIKey | KNFIVLMGYUCFGO-NDBQFGLNSA-N |
| XLogP | 6.91 |
| TPSA | 104.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.72 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|