C16H23NO2S — CID 60639753
6-(benzenesulfonyl)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octane (PubChem CID 60639753) has the molecular formula C16H23NO2S and a molecular weight of 293.43 g/mol. Its IUPAC name is 6-(benzenesulfonyl)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octane.
| Compound Name | 6-(benzenesulfonyl)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 60639753 |
| Molecular Formula | C16H23NO2S |
| Molecular Weight | 293.43 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 6-(benzenesulfonyl)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octane |
| SMILES | CC1(C)CC2CC(C)(CN2S(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C16H23NO2S/c1-15(2)9-13-10-16(3,11-15)12-17(13)20(18,19)14-7-5-4-6-8-14/h4-8,13H,9-12H2,1-3H3 |
| InChIKey | FPUKGFSQJNYRDN-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.43 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |