C28H33N5O3 — CID 136806356
2-[(Z)-benzylideneamino]oxy-N-[2-hydroxy-1-[[(1S,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]methyl]indol-3-yl]iminoacetamide (PubChem CID 136806356) has the molecular formula C28H33N5O3 and a molecular weight of 487.60 g/mol. Its IUPAC name is 2-[(Z)-benzylideneamino]oxy-N-[2-hydroxy-1-[[(1S,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]methyl]indol-3-yl]iminoacetamide.
| Compound Name | 2-[(Z)-benzylideneamino]oxy-N-[2-hydroxy-1-[[(1S,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]methyl]indol-3-yl]iminoacetamide |
|---|---|
| PubChem CID | 136806356 |
| Molecular Formula | C28H33N5O3 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.26 |
| IUPAC Name | 2-[(Z)-benzylideneamino]oxy-N-[2-hydroxy-1-[[(1S,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]methyl]indol-3-yl]iminoacetamide |
| SMILES | CC1(C)C[C@H]2C[C@@](C)(CN2Cn2c(O)c(/N=N/C(=O)CO/N=C\c3ccccc3)c3ccccc32)C1 |
| InChI | InChI=1S/C28H33N5O3/c1-27(2)13-21-14-28(3,17-27)18-32(21)19-33-23-12-8-7-11-22(23)25(26(33)35)31-30-24(34)16-36-29-15-20-9-5-4-6-10-20/h4-12,15,21,35H,13-14,16-19H2,1-3H3/b29-15-,31-30+/t21-,28+/m0/s1 |
| InChIKey | FUPJALYFGXBULW-BTOMWSRNSA-N |
| XLogP | 5.87 |
| TPSA | 91.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|