C19H17N5O5 — CID 136676044
ethyl 2-[2-hydroxy-3-[[6-[(Z)-hydroxyiminomethyl]pyridine-3-carbonyl]diazenyl]indol-1-yl]acetate (PubChem CID 136676044) has the molecular formula C19H17N5O5 and a molecular weight of 395.38 g/mol. Its IUPAC name is ethyl 2-[2-hydroxy-3-[[6-[(Z)-hydroxyiminomethyl]pyridine-3-carbonyl]diazenyl]indol-1-yl]acetate.
| Compound Name | ethyl 2-[2-hydroxy-3-[[6-[(Z)-hydroxyiminomethyl]pyridine-3-carbonyl]diazenyl]indol-1-yl]acetate |
|---|---|
| PubChem CID | 136676044 |
| Molecular Formula | C19H17N5O5 |
| Molecular Weight | 395.38 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | ethyl 2-[2-hydroxy-3-[[6-[(Z)-hydroxyiminomethyl]pyridine-3-carbonyl]diazenyl]indol-1-yl]acetate |
| SMILES | CCOC(=O)Cn1c(O)c(/N=N/C(=O)c2ccc(/C=N\O)nc2)c2ccccc21 |
| InChI | InChI=1S/C19H17N5O5/c1-2-29-16(25)11-24-15-6-4-3-5-14(15)17(19(24)27)22-23-18(26)12-7-8-13(10-21-28)20-9-12/h3-10,27-28H,2,11H2,1H3/b21-10-,23-22+ |
| InChIKey | FBUDJBILILWQDL-METTXCLHSA-N |
| XLogP | 3.04 |
| TPSA | 138.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.38 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|